About 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile
1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 39536966) has the molecular formula C17H13FN4O3
and a molecular weight of 340.31 g/mol. Its IUPAC name is 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 39536966 |
| Molecular Formula | C17H13FN4O3 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCn1cc(C#N)c(=O)n(Cc2cc(-c3ccc(F)cc3)no2)c1=O |
| InChI | InChI=1S/C17H13FN4O3/c1-2-21-9-12(8-19)16(23)22(17(21)24)10-14-7-15(20-25-14)11-3-5-13(18)6-4-11/h3-7,9H,2,10H2,1H3 |
| InChIKey | ASIRYZYIUSAGBS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 93.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile (CID 39536966) is 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile is CCn1cc(C#N)c(=O)n(Cc2cc(-c3ccc(F)cc3)no2)c1=O.
What is the InChIKey of 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is ASIRYZYIUSAGBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN4O3/c1-2-21-9-12(8-19)16(23)22(17(21)24)10-14-7-15(20-25-14)11-3-5-13(18)6-4-11/h3-7,9H,2,10H2,1H3.
What are the key properties of 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile?
1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 340.31 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[[3-(4-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 39536966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).