C18H15FN4OS — CID 39537017
5-[2-(3-fluorophenoxy)ethylsulfanyl]-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline (PubChem CID 39537017) has the molecular formula C18H15FN4OS and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[2-(3-fluorophenoxy)ethylsulfanyl]-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline.
| Compound Name | 5-[2-(3-fluorophenoxy)ethylsulfanyl]-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline |
|---|---|
| PubChem CID | 39537017 |
| Molecular Formula | C18H15FN4OS |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-[2-(3-fluorophenoxy)ethylsulfanyl]-2-methyl-[1,2,4]triazolo[1,5-c]quinazoline |
| SMILES | Cc1nc2c3ccccc3nc(SCCOc3cccc(F)c3)n2n1 |
| InChI | InChI=1S/C18H15FN4OS/c1-12-20-17-15-7-2-3-8-16(15)21-18(23(17)22-12)25-10-9-24-14-6-4-5-13(19)11-14/h2-8,11H,9-10H2,1H3 |
| InChIKey | MINDIFVOYFVQOE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|