C21H24ClNO2 — CID 3954071
1-[(3-chlorophenyl)-(4-ethylphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 3954071) has the molecular formula C21H24ClNO2 and a molecular weight of 357.88 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)-(4-ethylphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-chlorophenyl)-(4-ethylphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 3954071 |
| Molecular Formula | C21H24ClNO2 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[(3-chlorophenyl)-(4-ethylphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCc1ccc(C(c2cccc(Cl)c2)N2CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C21H24ClNO2/c1-2-15-6-8-16(9-7-15)20(18-4-3-5-19(22)14-18)23-12-10-17(11-13-23)21(24)25/h3-9,14,17,20H,2,10-13H2,1H3,(H,24,25) |
| InChIKey | SENUBXDVPBDZSU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |