C25H26ClN3O2S — CID 3955364
N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide (PubChem CID 3955364) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 3955364 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylphenyl]-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetamide |
| SMILES | COc1ccccc1N1CCN(CC(=O)Nc2ccccc2Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN3O2S/c1-31-23-8-4-3-7-22(23)29-16-14-28(15-17-29)18-25(30)27-21-6-2-5-9-24(21)32-20-12-10-19(26)11-13-20/h2-13H,14-18H2,1H3,(H,27,30) |
| InChIKey | WPGAPUWGVQXLBV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |