C22H23N3O5 — CID 3955456
3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 3955456) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3955456 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-5-(3,4-dimethoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(C)NC(=O)N(CC(=O)N3CCc4ccccc43)C2=O)cc1OC |
| InChI | InChI=1S/C22H23N3O5/c1-22(15-8-9-17(29-2)18(12-15)30-3)20(27)25(21(28)23-22)13-19(26)24-11-10-14-6-4-5-7-16(14)24/h4-9,12H,10-11,13H2,1-3H3,(H,23,28) |
| InChIKey | LIOMNGFGFJIRPM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|