C17H17IN2O4S — CID 3955565
4-iodo-N-(4-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 3955565) has the molecular formula C17H17IN2O4S and a molecular weight of 472.30 g/mol. Its IUPAC name is 4-iodo-N-(4-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 4-iodo-N-(4-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 3955565 |
| Molecular Formula | C17H17IN2O4S |
| Molecular Weight | 472.30 g/mol |
| Exact Mass | 472.00 |
| IUPAC Name | 4-iodo-N-(4-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H17IN2O4S/c18-14-3-1-13(2-4-14)17(21)19-15-5-7-16(8-6-15)25(22,23)20-9-11-24-12-10-20/h1-8H,9-12H2,(H,19,21) |
| InChIKey | QCWAATYZLIFZAB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|