C15H9Cl3O5 — CID 3955719
2',4',5-trichloro-3',6-dihydroxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohexa-2,4-diene]-1',3-dione (PubChem CID 3955719) has the molecular formula C15H9Cl3O5 and a molecular weight of 375.59 g/mol. Its IUPAC name is 2',4',5-trichloro-3',6-dihydroxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohexa-2,4-diene]-1',3-dione.
| Compound Name | 2',4',5-trichloro-3',6-dihydroxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohexa-2,4-diene]-1',3-dione |
|---|---|
| PubChem CID | 3955719 |
| Molecular Formula | C15H9Cl3O5 |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2',4',5-trichloro-3',6-dihydroxy-4,5'-dimethylspiro[1-benzofuran-2,6'-cyclohexa-2,4-diene]-1',3-dione |
| SMILES | CC1=C(Cl)C(O)=C(Cl)C(=O)C12Oc1cc(O)c(Cl)c(C)c1C2=O |
| InChI | InChI=1S/C15H9Cl3O5/c1-4-8-7(3-6(19)9(4)16)23-15(13(8)21)5(2)10(17)12(20)11(18)14(15)22/h3,19-20H,1-2H3 |
| InChIKey | RVTDBXFJFCDDRZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|