C24H24BrN3O4 — CID 39571359
5-bromo-2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 39571359) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is 5-bromo-2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 5-bromo-2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 39571359 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 5-bromo-2-[4-[4-(4-methylbenzoyl)piperazin-1-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C(=O)N2CCN(C(=O)CCCN3C(=O)c4ccc(Br)cc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C24H24BrN3O4/c1-16-4-6-17(7-5-16)22(30)27-13-11-26(12-14-27)21(29)3-2-10-28-23(31)19-9-8-18(25)15-20(19)24(28)32/h4-9,15H,2-3,10-14H2,1H3 |
| InChIKey | XYLQMLDMFVUNNF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|