C18H15N3O3 — CID 3957636
N-[4-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]phenyl]acetamide (PubChem CID 3957636) has the molecular formula C18H15N3O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is N-[4-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 3957636 |
| Molecular Formula | C18H15N3O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[4-[(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/N=C/c2nc(-c3ccccc3)oc2O)cc1 |
| InChI | InChI=1S/C18H15N3O3/c1-12(22)20-15-9-7-14(8-10-15)19-11-16-18(23)24-17(21-16)13-5-3-2-4-6-13/h2-11,23H,1H3,(H,20,22)/b19-11+ |
| InChIKey | DGXFXBXJADVLCI-YBFXNURJSA-N |
| XLogP | 3.76 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|