About 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile
3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile (PubChem CID 3957895) has the molecular formula C17H16ClN5O2S
and a molecular weight of 389.87 g/mol. Its IUPAC name is 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile.
Molecular Properties
| Compound Name | 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile |
| PubChem CID | 3957895 |
| Molecular Formula | C17H16ClN5O2S |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile |
| SMILES | Cn1c(=O)c2c(nc(SCCC#N)n2Cc2ccccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C17H16ClN5O2S/c1-21-14-13(15(24)22(2)17(21)25)23(16(20-14)26-9-5-8-19)10-11-6-3-4-7-12(11)18/h3-4,6-7H,5,9-10H2,1-2H3 |
| InChIKey | CIYTXQHHKSVQMW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile?
The IUPAC name of 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile (CID 3957895) is 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile.
What is the SMILES notation for 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile?
The canonical SMILES for 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile is Cn1c(=O)c2c(nc(SCCC#N)n2Cc2ccccc2Cl)n(C)c1=O.
What is the InChIKey of 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile?
The InChIKey is CIYTXQHHKSVQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClN5O2S/c1-21-14-13(15(24)22(2)17(21)25)23(16(20-14)26-9-5-8-19)10-11-6-3-4-7-12(11)18/h3-4,6-7H,5,9-10H2,1-2H3.
What are the key properties of 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile?
3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile has a molecular weight of 389.87 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[7-[(2-chlorophenyl)methyl]-1,3-dimethyl-2,6-dioxopurin-8-yl]sulfanylpropanenitrile is sourced from PubChem (CID 3957895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).