C14H13N3O2S — CID 3958079
[[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]thiourea (PubChem CID 3958079) has the molecular formula C14H13N3O2S and a molecular weight of 287.34 g/mol. Its IUPAC name is [[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]thiourea.
| Compound Name | [[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]thiourea |
|---|---|
| PubChem CID | 3958079 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | [[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]thiourea |
| SMILES | NC(=S)NN=C(c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H13N3O2S/c15-14(20)17-16-13(9-4-2-1-3-5-9)11-7-6-10(18)8-12(11)19/h1-8,18-19H,(H3,15,17,20) |
| InChIKey | FHRDXNKKAKKBED-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|