C21H31NO11 — CID 3958968
(2,3,4,5-tetraacetyloxy-6-oxo-6-piperidin-1-ylhexyl) acetate (PubChem CID 3958968) has the molecular formula C21H31NO11 and a molecular weight of 473.48 g/mol. Its IUPAC name is (2,3,4,5-tetraacetyloxy-6-oxo-6-piperidin-1-ylhexyl) acetate.
| Compound Name | (2,3,4,5-tetraacetyloxy-6-oxo-6-piperidin-1-ylhexyl) acetate |
|---|---|
| PubChem CID | 3958968 |
| Molecular Formula | C21H31NO11 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | (2,3,4,5-tetraacetyloxy-6-oxo-6-piperidin-1-ylhexyl) acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H31NO11/c1-12(23)29-11-17(30-13(2)24)18(31-14(3)25)19(32-15(4)26)20(33-16(5)27)21(28)22-9-7-6-8-10-22/h17-20H,6-11H2,1-5H3 |
| InChIKey | BHXGZZAZWHQQOJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 151.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|