About 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol
1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol (PubChem CID 3959151) has the molecular formula C22H29NO3
and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
| PubChem CID | 3959151 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol |
| SMILES | CC1CN(CC(O)COC(c2ccccc2)c2ccccc2)CC(C)O1 |
| InChI | InChI=1S/C22H29NO3/c1-17-13-23(14-18(2)26-17)15-21(24)16-25-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,21-22,24H,13-16H2,1-2H3 |
| InChIKey | SHNRXNHLXFMKGQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol?
The IUPAC name of 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol (CID 3959151) is 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol.
What is the SMILES notation for 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol?
The canonical SMILES for 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol is CC1CN(CC(O)COC(c2ccccc2)c2ccccc2)CC(C)O1.
What is the InChIKey of 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol?
The InChIKey is SHNRXNHLXFMKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO3/c1-17-13-23(14-18(2)26-17)15-21(24)16-25-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,17-18,21-22,24H,13-16H2,1-2H3.
What are the key properties of 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol?
1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol has a molecular weight of 355.48 g/mol, XLogP of 3.26, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryloxy-3-(2,6-dimethylmorpholin-4-yl)propan-2-ol is sourced from PubChem (CID 3959151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).