C14H13N5O4S — CID 3959402
3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 3959402) has the molecular formula C14H13N5O4S and a molecular weight of 347.36 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3959402 |
| Molecular Formula | C14H13N5O4S |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(=Cc2ccc(O)c(OCC)c2)C(=O)N1c1nonc1N |
| InChI | InChI=1S/C14H13N5O4S/c1-2-22-9-5-7(3-4-8(9)20)6-10-13(21)19(14(16)24-10)12-11(15)17-23-18-12/h3-6,16,20H,2H2,1H3,(H2,15,17)/b10-6?,16-14- |
| InChIKey | HXNOVJDHCKSUQI-PWTMZBNASA-N |
| XLogP | 1.81 |
| TPSA | 138.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|