About N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide
N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide (PubChem CID 39596248) has the molecular formula C18H24N2O3S2
and a molecular weight of 380.54 g/mol. Its IUPAC name is N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide.
Molecular Properties
| Compound Name | N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide |
| PubChem CID | 39596248 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide |
| SMILES | CC(C)(C)C[C@H](NC(=O)Cc1ccc(S(N)(=O)=O)s1)c1ccccc1 |
| InChI | InChI=1S/C18H24N2O3S2/c1-18(2,3)12-15(13-7-5-4-6-8-13)20-16(21)11-14-9-10-17(24-14)25(19,22)23/h4-10,15H,11-12H2,1-3H3,(H,20,21)(H2,19,22,23)/t15-/m0/s1 |
| InChIKey | BFZARPBUYIALSM-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide?
The IUPAC name of N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide (CID 39596248) is N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide.
What is the SMILES notation for N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide?
The canonical SMILES for N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide is CC(C)(C)C[C@H](NC(=O)Cc1ccc(S(N)(=O)=O)s1)c1ccccc1.
What is the InChIKey of N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide?
The InChIKey is BFZARPBUYIALSM-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H24N2O3S2/c1-18(2,3)12-15(13-7-5-4-6-8-13)20-16(21)11-14-9-10-17(24-14)25(19,22)23/h4-10,15H,11-12H2,1-3H3,(H,20,21)(H2,19,22,23)/t15-/m0/s1.
What are the key properties of N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide?
N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide has a molecular weight of 380.54 g/mol, XLogP of 3.23, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-3,3-dimethyl-1-phenylbutyl]-2-(5-sulfamoylthiophen-2-yl)acetamide is sourced from PubChem (CID 39596248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).