C9H6Cl2N4O — CID 3959697
2,4-dichloro-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 3959697) has the molecular formula C9H6Cl2N4O and a molecular weight of 257.08 g/mol. Its IUPAC name is 2,4-dichloro-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 3959697 |
| Molecular Formula | C9H6Cl2N4O |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2,4-dichloro-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H6Cl2N4O/c10-5-1-2-6(7(11)3-5)8(16)14-9-12-4-13-15-9/h1-4H,(H2,12,13,14,15,16) |
| InChIKey | VHBUMTUFVJNBSG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |