About [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea
[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea (PubChem CID 3960536) has the molecular formula C6H6BrN5O2S
and a molecular weight of 292.12 g/mol. Its IUPAC name is [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea |
| PubChem CID | 3960536 |
| Molecular Formula | C6H6BrN5O2S |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 290.94 |
| IUPAC Name | [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1[nH]c(=O)[nH]c(=O)c1Br |
| InChI | InChI=1S/C6H6BrN5O2S/c7-3-2(1-9-12-5(8)15)10-6(14)11-4(3)13/h1H,(H3,8,12,15)(H2,10,11,13,14) |
| InChIKey | UCSKGSASCXWUAR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea?
The IUPAC name of [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea (CID 3960536) is [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea.
What is the SMILES notation for [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea?
The canonical SMILES for [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea is NC(=S)NN=Cc1[nH]c(=O)[nH]c(=O)c1Br.
What is the InChIKey of [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea?
The InChIKey is UCSKGSASCXWUAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN5O2S/c7-3-2(1-9-12-5(8)15)10-6(14)11-4(3)13/h1H,(H3,8,12,15)(H2,10,11,13,14).
What are the key properties of [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea?
[(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea has a molecular weight of 292.12 g/mol, XLogP of -1.01, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-bromo-2,4-dioxo-1H-pyrimidin-6-yl)methylideneamino]thiourea is sourced from PubChem (CID 3960536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).