About [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (PubChem CID 3960556) has the molecular formula C20H22N2O6
and a molecular weight of 386.40 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| PubChem CID | 3960556 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate |
| SMILES | Cc1cc(C)c(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2NCCO)cc1C |
| InChI | InChI=1S/C20H22N2O6/c1-12-8-14(3)16(9-13(12)2)19(24)11-28-20(25)17-10-15(22(26)27)4-5-18(17)21-6-7-23/h4-5,8-10,21,23H,6-7,11H2,1-3H3 |
| InChIKey | CPUDFTXUFNNBOX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate?
The IUPAC name of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate (CID 3960556) is [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate.
What is the SMILES notation for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate?
The canonical SMILES for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate is Cc1cc(C)c(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2NCCO)cc1C.
What is the InChIKey of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate?
The InChIKey is CPUDFTXUFNNBOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O6/c1-12-8-14(3)16(9-13(12)2)19(24)11-28-20(25)17-10-15(22(26)27)4-5-18(17)21-6-7-23/h4-5,8-10,21,23H,6-7,11H2,1-3H3.
What are the key properties of [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate?
[2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate has a molecular weight of 386.40 g/mol, XLogP of 2.96, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2,4,5-trimethylphenyl)ethyl] 2-(2-hydroxyethylamino)-5-nitrobenzoate is sourced from PubChem (CID 3960556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).