About 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one (PubChem CID 3960859) has the molecular formula C11H16N2O2S2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one |
| PubChem CID | 3960859 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1csc(SCCC(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C11H16N2O2S2/c1-9-8-17-11(12-9)16-7-2-10(14)13-3-5-15-6-4-13/h8H,2-7H2,1H3 |
| InChIKey | SECMDVPAKPGOHA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one?
The IUPAC name of 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one (CID 3960859) is 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one.
What is the SMILES notation for 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one?
The canonical SMILES for 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one is Cc1csc(SCCC(=O)N2CCOCC2)n1.
What is the InChIKey of 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one?
The InChIKey is SECMDVPAKPGOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S2/c1-9-8-17-11(12-9)16-7-2-10(14)13-3-5-15-6-4-13/h8H,2-7H2,1H3.
What are the key properties of 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one?
3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one has a molecular weight of 272.39 g/mol, XLogP of 1.79, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]-1-morpholin-4-ylpropan-1-one is sourced from PubChem (CID 3960859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).