About 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide
3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 3961235) has the molecular formula C17H16ClF3N2O5S2
and a molecular weight of 484.91 g/mol. Its IUPAC name is 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
| PubChem CID | 3961235 |
| Molecular Formula | C17H16ClF3N2O5S2 |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2c(F)cc(F)c(Cl)c2F)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H16ClF3N2O5S2/c1-10-2-3-11(8-14(10)30(26,27)23-4-6-28-7-5-23)22-29(24,25)17-13(20)9-12(19)15(18)16(17)21/h2-3,8-9,22H,4-7H2,1H3 |
| InChIKey | RRBMVBFBSWFFBT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide?
The IUPAC name of 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide (CID 3961235) is 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide.
What is the SMILES notation for 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide?
The canonical SMILES for 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2c(F)cc(F)c(Cl)c2F)cc1S(=O)(=O)N1CCOCC1.
What is the InChIKey of 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide?
The InChIKey is RRBMVBFBSWFFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClF3N2O5S2/c1-10-2-3-11(8-14(10)30(26,27)23-4-6-28-7-5-23)22-29(24,25)17-13(20)9-12(19)15(18)16(17)21/h2-3,8-9,22H,4-7H2,1H3.
What are the key properties of 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide?
3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide has a molecular weight of 484.91 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,4,6-trifluoro-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)benzenesulfonamide is sourced from PubChem (CID 3961235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).