C19H21F3N4O4 — CID 39618851
1-cyclopropyl-2,4-dioxo-N-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 39618851) has the molecular formula C19H21F3N4O4 and a molecular weight of 426.40 g/mol. Its IUPAC name is 1-cyclopropyl-2,4-dioxo-N-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1-cyclopropyl-2,4-dioxo-N-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 39618851 |
| Molecular Formula | C19H21F3N4O4 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-cyclopropyl-2,4-dioxo-N-[(1S,3R)-3-(2,2,2-trifluoroethoxy)cyclohexyl]pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | O=C(N[C@H]1CCC[C@@H](OCC(F)(F)F)C1)c1cnc2c(c1)c(=O)[nH]c(=O)n2C1CC1 |
| InChI | InChI=1S/C19H21F3N4O4/c20-19(21,22)9-30-13-3-1-2-11(7-13)24-16(27)10-6-14-15(23-8-10)26(12-4-5-12)18(29)25-17(14)28/h6,8,11-13H,1-5,7,9H2,(H,24,27)(H,25,28,29)/t11-,13+/m0/s1 |
| InChIKey | FPRCUDXYKQIBBU-WCQYABFASA-N |
| XLogP | 2.04 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |