C28H22N2O5 — CID 3962266
4-[[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]naphthalen-2-yl]oxymethyl]benzoic acid (PubChem CID 3962266) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is 4-[[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]naphthalen-2-yl]oxymethyl]benzoic acid.
| Compound Name | 4-[[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]naphthalen-2-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 3962266 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 4-[[1-[(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)iminomethyl]naphthalen-2-yl]oxymethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2ccc3ccccc3c2C=NN2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C28H22N2O5/c31-26-24-19-9-10-20(13-19)25(24)27(32)30(26)29-14-22-21-4-2-1-3-17(21)11-12-23(22)35-15-16-5-7-18(8-6-16)28(33)34/h1-12,14,19-20,24-25H,13,15H2,(H,33,34) |
| InChIKey | ONZIEDSUQZKQAQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|