C17H16FN3O2 — CID 3962498
1-(3-fluorophenyl)-3-(2-pyridin-4-ylethylamino)pyrrolidine-2,5-dione (PubChem CID 3962498) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-3-(2-pyridin-4-ylethylamino)pyrrolidine-2,5-dione.
| Compound Name | 1-(3-fluorophenyl)-3-(2-pyridin-4-ylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 3962498 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-(3-fluorophenyl)-3-(2-pyridin-4-ylethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCCc2ccncc2)C(=O)N1c1cccc(F)c1 |
| InChI | InChI=1S/C17H16FN3O2/c18-13-2-1-3-14(10-13)21-16(22)11-15(17(21)23)20-9-6-12-4-7-19-8-5-12/h1-5,7-8,10,15,20H,6,9,11H2 |
| InChIKey | BLBSYBUYXNCHIF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|