C16H15Cl3N6O3 — CID 3962845
N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]furan-2-carboxamide (PubChem CID 3962845) has the molecular formula C16H15Cl3N6O3 and a molecular weight of 445.69 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3962845 |
| Molecular Formula | C16H15Cl3N6O3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | N-[2,2,2-trichloro-1-(6-morpholin-4-ylpurin-9-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(n1cnc2c(N3CCOCC3)ncnc21)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C16H15Cl3N6O3/c17-16(18,19)15(23-14(26)10-2-1-5-28-10)25-9-22-11-12(20-8-21-13(11)25)24-3-6-27-7-4-24/h1-2,5,8-9,15H,3-4,6-7H2,(H,23,26) |
| InChIKey | PABJAEBQPNZCMU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|