C18H18N4O3S — CID 39630963
1,3-dimethyl-2,4-dioxo-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 39630963) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 39630963 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N-(2-phenylsulfanylethyl)pyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | Cn1c(=O)c2ccc(C(=O)NCCSc3ccccc3)nc2n(C)c1=O |
| InChI | InChI=1S/C18H18N4O3S/c1-21-15-13(17(24)22(2)18(21)25)8-9-14(20-15)16(23)19-10-11-26-12-6-4-3-5-7-12/h3-9H,10-11H2,1-2H3,(H,19,23) |
| InChIKey | IKWSATFZJOKTMR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|