C32H34N4O2 — CID 3964994
N-benzyl-N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 3964994) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is N-benzyl-N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | N-benzyl-N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3964994 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-benzyl-N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccccc1-n1nc(C(C)(C)C)cc1NC(=O)CN(Cc1ccccc1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C32H34N4O2/c1-24-13-11-12-18-27(24)36-29(21-28(34-36)32(2,3)4)33-30(37)23-35(22-26-16-9-6-10-17-26)31(38)20-19-25-14-7-5-8-15-25/h5-21H,22-23H2,1-4H3,(H,33,37) |
| InChIKey | PBAAECQGCNJVHG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|