About 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (PubChem CID 3966) has the molecular formula C15H26N2
and a molecular weight of 234.39 g/mol. Its IUPAC name is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
Molecular Properties
| Compound Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| PubChem CID | 3966 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane |
| SMILES | C1CCN2CC3CC(CN4CCCCC34)C2C1 |
| InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2 |
| InChIKey | SLRCCWJSBJZJBV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The IUPAC name of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane (CID 3966) is 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane.
What is the SMILES notation for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The canonical SMILES for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane is C1CCN2CC3CC(CN4CCCCC34)C2C1.
What is the InChIKey of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
The InChIKey is SLRCCWJSBJZJBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2.
What are the key properties of 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane?
7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane has a molecular weight of 234.39 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,15-diazatetracyclo[7.7.1.02,7.010,15]heptadecane is sourced from PubChem (CID 3966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).