C17H26N2O4S — CID 39664343
methyl 4-[[(2R)-2-[(2S)-2-methylpiperidin-1-yl]propyl]sulfamoyl]benzoate (PubChem CID 39664343) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is methyl 4-[[(2R)-2-[(2S)-2-methylpiperidin-1-yl]propyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[(2R)-2-[(2S)-2-methylpiperidin-1-yl]propyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 39664343 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | methyl 4-[[(2R)-2-[(2S)-2-methylpiperidin-1-yl]propyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NC[C@@H](C)N2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C17H26N2O4S/c1-13-6-4-5-11-19(13)14(2)12-18-24(21,22)16-9-7-15(8-10-16)17(20)23-3/h7-10,13-14,18H,4-6,11-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | NXCHVFFVTCLFRT-UONOGXRCSA-N |
| XLogP | 2.01 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |