C14H17NO2 — CID 3967307
N-(4-methoxyphenyl)spiro[2.3]hexane-2-carboxamide (PubChem CID 3967307) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is N-(4-methoxyphenyl)spiro[2.3]hexane-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)spiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 3967307 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-(4-methoxyphenyl)spiro[2.3]hexane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CC23CCC3)cc1 |
| InChI | InChI=1S/C14H17NO2/c1-17-11-5-3-10(4-6-11)15-13(16)12-9-14(12)7-2-8-14/h3-6,12H,2,7-9H2,1H3,(H,15,16) |
| InChIKey | ARBZHNBCGNQINX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |