About (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate
(3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate (PubChem CID 3967679) has the molecular formula C19H14F2O6
and a molecular weight of 376.31 g/mol. Its IUPAC name is (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate.
Molecular Properties
| Compound Name | (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate |
| PubChem CID | 3967679 |
| Molecular Formula | C19H14F2O6 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate |
| SMILES | O=C(OCC1OC(=O)C(F)(F)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2 |
| InChIKey | SHHNEUNVMZNOID-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate?
The IUPAC name of (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate (CID 3967679) is (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate.
What is the SMILES notation for (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate?
The canonical SMILES for (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate is O=C(OCC1OC(=O)C(F)(F)C1OC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate?
The InChIKey is SHHNEUNVMZNOID-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F2O6/c20-19(21)15(27-17(23)13-9-5-2-6-10-13)14(26-18(19)24)11-25-16(22)12-7-3-1-4-8-12/h1-10,14-15H,11H2.
What are the key properties of (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate?
(3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate has a molecular weight of 376.31 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzoyloxy-4,4-difluoro-5-oxooxolan-2-yl)methyl benzoate is sourced from PubChem (CID 3967679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).