C17H29NO — CID 3968
2,6-ditert-butyl-4-(ethylaminomethyl)phenol (PubChem CID 3968) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(ethylaminomethyl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(ethylaminomethyl)phenol |
|---|---|
| PubChem CID | 3968 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(ethylaminomethyl)phenol |
| SMILES | CCNCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO/c1-8-18-11-12-9-13(16(2,3)4)15(19)14(10-12)17(5,6)7/h9-10,18-19H,8,11H2,1-7H3 |
| InChIKey | WQNYIWJBDGLKEB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |