C17H13Cl2NO2 — CID 3968592
N-(3,5-dichlorophenyl)-2-(6-methyl-1-benzofuran-3-yl)acetamide (PubChem CID 3968592) has the molecular formula C17H13Cl2NO2 and a molecular weight of 334.20 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(6-methyl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(6-methyl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 3968592 |
| Molecular Formula | C17H13Cl2NO2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(6-methyl-1-benzofuran-3-yl)acetamide |
| SMILES | Cc1ccc2c(CC(=O)Nc3cc(Cl)cc(Cl)c3)coc2c1 |
| InChI | InChI=1S/C17H13Cl2NO2/c1-10-2-3-15-11(9-22-16(15)4-10)5-17(21)20-14-7-12(18)6-13(19)8-14/h2-4,6-9H,5H2,1H3,(H,20,21) |
| InChIKey | RCSWDGVJIIHOBG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |