C22H22N5O5S+ — CID 3968609
3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 3968609) has the molecular formula C22H22N5O5S+ and a molecular weight of 468.52 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3968609 |
| Molecular Formula | C22H22N5O5S+ |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-4-hydroxy-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1nc(C)c(C(=O)C2=C(O)C(=O)N(CCC[n+]3cc[nH]c3)C2c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C22H21N5O5S/c1-13-21(33-14(2)24-13)19(28)17-18(15-4-6-16(7-5-15)27(31)32)26(22(30)20(17)29)10-3-9-25-11-8-23-12-25/h4-8,11-12,18H,3,9-10H2,1-2H3,(H,28,29)/p+1 |
| InChIKey | KUXHUTSOBBHBQY-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|