About 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one
5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one (PubChem CID 3969321) has the molecular formula C14H10N2OS
and a molecular weight of 254.31 g/mol. Its IUPAC name is 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
| PubChem CID | 3969321 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one |
| SMILES | O=C1c2ccccc2NC2Sc3ccccc3N12 |
| InChI | InChI=1S/C14H10N2OS/c17-13-9-5-1-2-6-10(9)15-14-16(13)11-7-3-4-8-12(11)18-14/h1-8,14-15H |
| InChIKey | PYZFYNTUPROYOJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one?
The IUPAC name of 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one (CID 3969321) is 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one.
What is the SMILES notation for 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one?
The canonical SMILES for 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one is O=C1c2ccccc2NC2Sc3ccccc3N12.
What is the InChIKey of 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one?
The InChIKey is PYZFYNTUPROYOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2OS/c17-13-9-5-1-2-6-10(9)15-14-16(13)11-7-3-4-8-12(11)18-14/h1-8,14-15H.
What are the key properties of 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one?
5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one has a molecular weight of 254.31 g/mol, XLogP of 3.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5a-dihydro-[1,3]benzothiazolo[2,3-b]quinazolin-12-one is sourced from PubChem (CID 3969321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).