About dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate
dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3969534) has the molecular formula C23H22FN3O7
and a molecular weight of 471.44 g/mol. Its IUPAC name is dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate |
| PubChem CID | 3969534 |
| Molecular Formula | C23H22FN3O7 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CC2C(=O)NCCN2C(=O)c2ccc(F)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C23H22FN3O7/c1-33-22(31)14-9-15(23(32)34-2)11-17(10-14)26-19(28)12-18-20(29)25-7-8-27(18)21(30)13-3-5-16(24)6-4-13/h3-6,9-11,18H,7-8,12H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | WLLLPWSMOQORKE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate?
The IUPAC name of dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate (CID 3969534) is dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate.
What is the SMILES notation for dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate?
The canonical SMILES for dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate is COC(=O)c1cc(NC(=O)CC2C(=O)NCCN2C(=O)c2ccc(F)cc2)cc(C(=O)OC)c1.
What is the InChIKey of dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate?
The InChIKey is WLLLPWSMOQORKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FN3O7/c1-33-22(31)14-9-15(23(32)34-2)11-17(10-14)26-19(28)12-18-20(29)25-7-8-27(18)21(30)13-3-5-16(24)6-4-13/h3-6,9-11,18H,7-8,12H2,1-2H3,(H,25,29)(H,26,28).
What are the key properties of dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate?
dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate has a molecular weight of 471.44 g/mol, XLogP of 1.37, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 5-[[2-[1-(4-fluorobenzoyl)-3-oxopiperazin-2-yl]acetyl]amino]benzene-1,3-dicarboxylate is sourced from PubChem (CID 3969534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).