C29H27N3O8 — CID 3969616
methyl 3-benzyl-5-(2-methoxy-4-nitrophenyl)-1-(4-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 3969616) has the molecular formula C29H27N3O8 and a molecular weight of 545.55 g/mol. Its IUPAC name is methyl 3-benzyl-5-(2-methoxy-4-nitrophenyl)-1-(4-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl 3-benzyl-5-(2-methoxy-4-nitrophenyl)-1-(4-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 3969616 |
| Molecular Formula | C29H27N3O8 |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | methyl 3-benzyl-5-(2-methoxy-4-nitrophenyl)-1-(4-methoxyphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)C1(Cc2ccccc2)NC(c2ccc(OC)cc2)C2C(=O)N(c3ccc([N+](=O)[O-])cc3OC)C(=O)C21 |
| InChI | InChI=1S/C29H27N3O8/c1-38-20-12-9-18(10-13-20)25-23-24(29(30-25,28(35)40-3)16-17-7-5-4-6-8-17)27(34)31(26(23)33)21-14-11-19(32(36)37)15-22(21)39-2/h4-15,23-25,30H,16H2,1-3H3 |
| InChIKey | UWOSZSPKPAQUJM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|