C26H27NO4 — CID 3971301
1-[(3-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid (PubChem CID 3971301) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(3-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3971301 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[(3-methoxyphenyl)-(2-phenylmethoxyphenyl)methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1cccc(C(c2ccccc2OCc2ccccc2)N2CCCC2C(=O)O)c1 |
| InChI | InChI=1S/C26H27NO4/c1-30-21-12-7-11-20(17-21)25(27-16-8-14-23(27)26(28)29)22-13-5-6-15-24(22)31-18-19-9-3-2-4-10-19/h2-7,9-13,15,17,23,25H,8,14,16,18H2,1H3,(H,28,29) |
| InChIKey | RCJXNGLVRHHDPG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |