C22H25ClN4O4 — CID 39713471
[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone (PubChem CID 39713471) has the molecular formula C22H25ClN4O4 and a molecular weight of 444.92 g/mol. Its IUPAC name is [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone.
| Compound Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 39713471 |
| Molecular Formula | C22H25ClN4O4 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | [4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(4-morpholin-4-yl-3-nitrophenyl)methanone |
| SMILES | O=C(c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H25ClN4O4/c23-19-3-1-2-17(14-19)16-24-6-8-26(9-7-24)22(28)18-4-5-20(21(15-18)27(29)30)25-10-12-31-13-11-25/h1-5,14-15H,6-13,16H2 |
| InChIKey | CNCWFNMFCTWHJQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|