C17H24N2O4 — CID 39717828
1-[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]piperidine-4-carboxamide (PubChem CID 39717828) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39717828 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 1-[(2R)-2-[(3-methoxyphenyl)methoxy]propanoyl]piperidine-4-carboxamide |
| SMILES | COc1cccc(CO[C@H](C)C(=O)N2CCC(C(N)=O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O4/c1-12(23-11-13-4-3-5-15(10-13)22-2)17(21)19-8-6-14(7-9-19)16(18)20/h3-5,10,12,14H,6-9,11H2,1-2H3,(H2,18,20)/t12-/m1/s1 |
| InChIKey | GFSWOGDKLGYUMH-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |