C26H31ClN4O2 — CID 3972116
N-benzyl-N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloropropanamide (PubChem CID 3972116) has the molecular formula C26H31ClN4O2 and a molecular weight of 467.01 g/mol. Its IUPAC name is N-benzyl-N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloropropanamide.
| Compound Name | N-benzyl-N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloropropanamide |
|---|---|
| PubChem CID | 3972116 |
| Molecular Formula | C26H31ClN4O2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-benzyl-N-[2-[[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloropropanamide |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)CN(Cc2ccccc2)C(=O)C(C)Cl)cc1 |
| InChI | InChI=1S/C26H31ClN4O2/c1-18-11-13-21(14-12-18)31-23(15-22(29-31)26(3,4)5)28-24(32)17-30(25(33)19(2)27)16-20-9-7-6-8-10-20/h6-15,19H,16-17H2,1-5H3,(H,28,32) |
| InChIKey | MKKATVGBFSRTFX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|