About 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol
4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol (PubChem CID 3972627) has the molecular formula C22H17ClN2O2
and a molecular weight of 376.84 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol |
| PubChem CID | 3972627 |
| Molecular Formula | C22H17ClN2O2 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol |
| SMILES | CCc1ccc2oc(-c3cc(/N=C/c4ccc(Cl)cc4)ccc3O)nc2c1 |
| InChI | InChI=1S/C22H17ClN2O2/c1-2-14-5-10-21-19(11-14)25-22(27-21)18-12-17(8-9-20(18)26)24-13-15-3-6-16(23)7-4-15/h3-13,26H,2H2,1H3/b24-13+ |
| InChIKey | QFTPAFMPMVOUFJ-ZMOGYAJESA-N |
| XLogP | 6.17 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol?
The IUPAC name of 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol (CID 3972627) is 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol.
What is the SMILES notation for 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol?
The canonical SMILES for 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol is CCc1ccc2oc(-c3cc(/N=C/c4ccc(Cl)cc4)ccc3O)nc2c1.
What is the InChIKey of 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol?
The InChIKey is QFTPAFMPMVOUFJ-ZMOGYAJESA-N. The full InChI is InChI=1S/C22H17ClN2O2/c1-2-14-5-10-21-19(11-14)25-22(27-21)18-12-17(8-9-20(18)26)24-13-15-3-6-16(23)7-4-15/h3-13,26H,2H2,1H3/b24-13+.
What are the key properties of 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol?
4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol has a molecular weight of 376.84 g/mol, XLogP of 6.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chlorophenyl)methylideneamino]-2-(5-ethyl-1,3-benzoxazol-2-yl)phenol is sourced from PubChem (CID 3972627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).