C8H15N5O — CID 39730547
(2R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanehydrazide (PubChem CID 39730547) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is (2R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanehydrazide.
| Compound Name | (2R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanehydrazide |
|---|---|
| PubChem CID | 39730547 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | (2R)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)-2-methylpropanehydrazide |
| SMILES | Cc1nc(C)n(C[C@@H](C)C(=O)NN)n1 |
| InChI | InChI=1S/C8H15N5O/c1-5(8(14)11-9)4-13-7(3)10-6(2)12-13/h5H,4,9H2,1-3H3,(H,11,14)/t5-/m1/s1 |
| InChIKey | RHDMJCXDWVTEKA-RXMQYKEDSA-N |
| XLogP | -0.48 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|