C12H13NO3S — CID 39732832
(2S)-3-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)butanoic acid (PubChem CID 39732832) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is (2S)-3-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)butanoic acid.
| Compound Name | (2S)-3-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)butanoic acid |
|---|---|
| PubChem CID | 39732832 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | (2S)-3-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)butanoic acid |
| SMILES | CC(C)[C@@H](C(=O)O)n1sc2ccccc2c1=O |
| InChI | InChI=1S/C12H13NO3S/c1-7(2)10(12(15)16)13-11(14)8-5-3-4-6-9(8)17-13/h3-7,10H,1-2H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | WWXBUKVYEVDASM-JTQLQIEISA-N |
| XLogP | 2.34 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |