About 5-cyano-N,N-dimethylfuran-2-sulfonamide
5-cyano-N,N-dimethylfuran-2-sulfonamide (PubChem CID 39733385) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 5-cyano-N,N-dimethylfuran-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N,N-dimethylfuran-2-sulfonamide |
| PubChem CID | 39733385 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 5-cyano-N,N-dimethylfuran-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C#N)o1 |
| InChI | InChI=1S/C7H8N2O3S/c1-9(2)13(10,11)7-4-3-6(5-8)12-7/h3-4H,1-2H3 |
| InChIKey | IBDBMESSGLMGQS-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyano-N,N-dimethylfuran-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N,N-dimethylfuran-2-sulfonamide?
The IUPAC name of 5-cyano-N,N-dimethylfuran-2-sulfonamide (CID 39733385) is 5-cyano-N,N-dimethylfuran-2-sulfonamide.
What is the SMILES notation for 5-cyano-N,N-dimethylfuran-2-sulfonamide?
The canonical SMILES for 5-cyano-N,N-dimethylfuran-2-sulfonamide is CN(C)S(=O)(=O)c1ccc(C#N)o1.
What is the InChIKey of 5-cyano-N,N-dimethylfuran-2-sulfonamide?
The InChIKey is IBDBMESSGLMGQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-9(2)13(10,11)7-4-3-6(5-8)12-7/h3-4H,1-2H3.
What are the key properties of 5-cyano-N,N-dimethylfuran-2-sulfonamide?
5-cyano-N,N-dimethylfuran-2-sulfonamide has a molecular weight of 200.22 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N,N-dimethylfuran-2-sulfonamide is sourced from PubChem (CID 39733385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).