C19H15ClF3N3O2S2 — CID 39735195
5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(5-cyclopentylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (PubChem CID 39735195) has the molecular formula C19H15ClF3N3O2S2 and a molecular weight of 473.93 g/mol. Its IUPAC name is 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(5-cyclopentylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide.
| Compound Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(5-cyclopentylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 39735195 |
| Molecular Formula | C19H15ClF3N3O2S2 |
| Molecular Weight | 473.93 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 5-[2-chloro-5-(trifluoromethyl)phenyl]-N-(5-cyclopentylsulfanyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nnc(SC2CCCC2)s1)c1ccc(-c2cc(C(F)(F)F)ccc2Cl)o1 |
| InChI | InChI=1S/C19H15ClF3N3O2S2/c20-13-6-5-10(19(21,22)23)9-12(13)14-7-8-15(28-14)16(27)24-17-25-26-18(30-17)29-11-3-1-2-4-11/h5-9,11H,1-4H2,(H,24,25,27) |
| InChIKey | CZCMPWUSGPIRJO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.93 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|