C22H27N5O2 — CID 39735359
1-(4-methoxyphenyl)-3-[1-(2-piperidin-1-ylethyl)benzimidazol-2-yl]urea (PubChem CID 39735359) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[1-(2-piperidin-1-ylethyl)benzimidazol-2-yl]urea.
| Compound Name | 1-(4-methoxyphenyl)-3-[1-(2-piperidin-1-ylethyl)benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 39735359 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[1-(2-piperidin-1-ylethyl)benzimidazol-2-yl]urea |
| SMILES | COc1ccc(NC(=O)Nc2nc3ccccc3n2CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H27N5O2/c1-29-18-11-9-17(10-12-18)23-22(28)25-21-24-19-7-3-4-8-20(19)27(21)16-15-26-13-5-2-6-14-26/h3-4,7-12H,2,5-6,13-16H2,1H3,(H2,23,24,25,28) |
| InChIKey | ZWWRCSBSDIQHOU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_imidazole(1)', 'substructure': 'N/A'} |
|---|