C24H29N3O3S2 — CID 39735919
N-[(3aR,6aS)-3-[4-(diethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide (PubChem CID 39735919) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-[4-(diethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide.
| Compound Name | N-[(3aR,6aS)-3-[4-(diethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
|---|---|
| PubChem CID | 39735919 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | N-[(3aR,6aS)-3-[4-(diethylamino)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
| SMILES | CCN(CC)c1ccc(N2/C(=N/C(=O)CCc3ccccc3)S[C@@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C24H29N3O3S2/c1-3-26(4-2)19-11-13-20(14-12-19)27-21-16-32(29,30)17-22(21)31-24(27)25-23(28)15-10-18-8-6-5-7-9-18/h5-9,11-14,21-22H,3-4,10,15-17H2,1-2H3/b25-24-/t21-,22-/m1/s1 |
| InChIKey | YWDSHRYHEKFNSY-OMSYMFARSA-N |
| XLogP | 3.77 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|