C25H21FN2O4S2 — CID 39737225
N-[(3aS,6aR)-5,5-dioxo-3-(4-phenoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-fluorophenyl)acetamide (PubChem CID 39737225) has the molecular formula C25H21FN2O4S2 and a molecular weight of 496.59 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-(4-phenoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-(4-phenoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 39737225 |
| Molecular Formula | C25H21FN2O4S2 |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-(4-phenoxyphenyl)-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H21FN2O4S2/c26-18-8-6-17(7-9-18)14-24(29)27-25-28(22-15-34(30,31)16-23(22)33-25)19-10-12-21(13-11-19)32-20-4-2-1-3-5-20/h1-13,22-23H,14-16H2/b27-25-/t22-,23-/m0/s1 |
| InChIKey | UOCQHEOTHIBQIF-KZPFVTHQSA-N |
| XLogP | 4.46 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|