About [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 3973740) has the molecular formula C16H21ClN2O3
and a molecular weight of 324.81 g/mol. Its IUPAC name is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| PubChem CID | 3973740 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | CC1CCCC(NC(=O)COC(=O)c2ccc(Cl)nc2)C1C |
| InChI | InChI=1S/C16H21ClN2O3/c1-10-4-3-5-13(11(10)2)19-15(20)9-22-16(21)12-6-7-14(17)18-8-12/h6-8,10-11,13H,3-5,9H2,1-2H3,(H,19,20) |
| InChIKey | WALAIACBLRXHMO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The IUPAC name of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (CID 3973740) is [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
What is the SMILES notation for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The canonical SMILES for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate is CC1CCCC(NC(=O)COC(=O)c2ccc(Cl)nc2)C1C.
What is the InChIKey of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
The InChIKey is WALAIACBLRXHMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN2O3/c1-10-4-3-5-13(11(10)2)19-15(20)9-22-16(21)12-6-7-14(17)18-8-12/h6-8,10-11,13H,3-5,9H2,1-2H3,(H,19,20).
What are the key properties of [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate?
[2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate has a molecular weight of 324.81 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,3-dimethylcyclohexyl)amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate is sourced from PubChem (CID 3973740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).