C20H18F2N2O4S2 — CID 39738599
N-[(3aS,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 39738599) has the molecular formula C20H18F2N2O4S2 and a molecular weight of 452.50 g/mol. Its IUPAC name is N-[(3aS,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39738599 |
| Molecular Formula | C20H18F2N2O4S2 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N-[(3aS,6aS)-3-(2,4-difluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@@H]3N2c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H18F2N2O4S2/c1-28-14-5-2-12(3-6-14)8-19(25)23-20-24(16-7-4-13(21)9-15(16)22)17-10-30(26,27)11-18(17)29-20/h2-7,9,17-18H,8,10-11H2,1H3/b23-20-/t17-,18+/m0/s1 |
| InChIKey | PMWSRDRJZCYUPR-BKSSVATDSA-N |
| XLogP | 2.82 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|